C36H44N4 — CID 519828
2,3,7,8,12,13,17,18-octaethylporphyrin (PubChem CID 519828) has the molecular formula C36H44N4 and a molecular weight of 532.78 g/mol. Its IUPAC name is 2,3,7,8,12,13,17,18-octaethylporphyrin.
| Compound Name | 2,3,7,8,12,13,17,18-octaethylporphyrin |
|---|---|
| PubChem CID | 519828 |
| Molecular Formula | C36H44N4 |
| Molecular Weight | 532.78 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | 2,3,7,8,12,13,17,18-octaethylporphyrin |
| SMILES | CCC1=C(CC)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C(CC)=C5CC)C(CC)=C4CC)C(CC)=C3CC |
| InChI | InChI=1S/C36H44N4/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30/h17-20H,9-16H2,1-8H3/b29-17-,30-18-,31-17-,32-18-,33-19-,34-20-,35-19-,36-20- |
| InChIKey | IOHGVYCKSQNOFK-MUZKIALCSA-N |
| XLogP | 9.82 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.78 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |