C20H25N3O2 — CID 51983604
N-[[2-[[(2S)-2-methylpiperidin-1-yl]methyl]phenyl]methyl]-1-oxidopyridin-1-ium-3-carboxamide (PubChem CID 51983604) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[[2-[[(2S)-2-methylpiperidin-1-yl]methyl]phenyl]methyl]-1-oxidopyridin-1-ium-3-carboxamide.
| Compound Name | N-[[2-[[(2S)-2-methylpiperidin-1-yl]methyl]phenyl]methyl]-1-oxidopyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 51983604 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-[[2-[[(2S)-2-methylpiperidin-1-yl]methyl]phenyl]methyl]-1-oxidopyridin-1-ium-3-carboxamide |
| SMILES | C[C@H]1CCCCN1Cc1ccccc1CNC(=O)c1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C20H25N3O2/c1-16-7-4-5-11-22(16)14-18-9-3-2-8-17(18)13-21-20(24)19-10-6-12-23(25)15-19/h2-3,6,8-10,12,15-16H,4-5,7,11,13-14H2,1H3,(H,21,24)/t16-/m0/s1 |
| InChIKey | UKRCHYMISGGFQW-INIZCTEOSA-N |
| XLogP | 2.62 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|