C15H22N2O3S — CID 51984543
2-acetyl-N-tert-butyl-3,4-dihydro-1H-isoquinoline-7-sulfonamide (PubChem CID 51984543) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-acetyl-N-tert-butyl-3,4-dihydro-1H-isoquinoline-7-sulfonamide.
| Compound Name | 2-acetyl-N-tert-butyl-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
|---|---|
| PubChem CID | 51984543 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-acetyl-N-tert-butyl-3,4-dihydro-1H-isoquinoline-7-sulfonamide |
| SMILES | CC(=O)N1CCc2ccc(S(=O)(=O)NC(C)(C)C)cc2C1 |
| InChI | InChI=1S/C15H22N2O3S/c1-11(18)17-8-7-12-5-6-14(9-13(12)10-17)21(19,20)16-15(2,3)4/h5-6,9,16H,7-8,10H2,1-4H3 |
| InChIKey | AQVCSPHFSLACRJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |