C16H21N3O4 — CID 51984943
(1S,6S)-6-[(2S)-2-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carbonyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 51984943) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is (1S,6S)-6-[(2S)-2-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carbonyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6S)-6-[(2S)-2-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carbonyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 51984943 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | (1S,6S)-6-[(2S)-2-(3-methyl-1,2,4-oxadiazol-5-yl)piperidine-1-carbonyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | Cc1noc([C@@H]2CCCCN2C(=O)[C@H]2CC=CC[C@@H]2C(=O)O)n1 |
| InChI | InChI=1S/C16H21N3O4/c1-10-17-14(23-18-10)13-8-4-5-9-19(13)15(20)11-6-2-3-7-12(11)16(21)22/h2-3,11-13H,4-9H2,1H3,(H,21,22)/t11-,12-,13-/m0/s1 |
| InChIKey | XPSVZQYBIWQLRI-AVGNSLFASA-N |
| XLogP | 2.10 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|