About methyl 2,6-dihydroxybenzoate
methyl 2,6-dihydroxybenzoate (PubChem CID 519869) has the molecular formula C8H8O4
and a molecular weight of 168.15 g/mol. Its IUPAC name is methyl 2,6-dihydroxybenzoate.
Molecular Properties
| Compound Name | methyl 2,6-dihydroxybenzoate |
| PubChem CID | 519869 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | methyl 2,6-dihydroxybenzoate |
| SMILES | COC(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C8H8O4/c1-12-8(11)7-5(9)3-2-4-6(7)10/h2-4,9-10H,1H3 |
| InChIKey | WCQZCKUNZVMBDC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2,6-dihydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,6-dihydroxybenzoate?
The IUPAC name of methyl 2,6-dihydroxybenzoate (CID 519869) is methyl 2,6-dihydroxybenzoate.
What is the SMILES notation for methyl 2,6-dihydroxybenzoate?
The canonical SMILES for methyl 2,6-dihydroxybenzoate is COC(=O)c1c(O)cccc1O.
What is the InChIKey of methyl 2,6-dihydroxybenzoate?
The InChIKey is WCQZCKUNZVMBDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4/c1-12-8(11)7-5(9)3-2-4-6(7)10/h2-4,9-10H,1H3.
What are the key properties of methyl 2,6-dihydroxybenzoate?
methyl 2,6-dihydroxybenzoate has a molecular weight of 168.15 g/mol, XLogP of 0.88, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,6-dihydroxybenzoate is sourced from PubChem (CID 519869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).