About methyl 2-methylpentanoate
methyl 2-methylpentanoate (PubChem CID 519890) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is methyl 2-methylpentanoate.
Molecular Properties
| Compound Name | methyl 2-methylpentanoate |
| PubChem CID | 519890 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | methyl 2-methylpentanoate |
| SMILES | CCCC(C)C(=O)OC |
| InChI | InChI=1S/C7H14O2/c1-4-5-6(2)7(8)9-3/h6H,4-5H2,1-3H3 |
| InChIKey | ZTULNMNIVVMLIU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 2-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylpentanoate?
The IUPAC name of methyl 2-methylpentanoate (CID 519890) is methyl 2-methylpentanoate.
What is the SMILES notation for methyl 2-methylpentanoate?
The canonical SMILES for methyl 2-methylpentanoate is CCCC(C)C(=O)OC.
What is the InChIKey of methyl 2-methylpentanoate?
The InChIKey is ZTULNMNIVVMLIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2/c1-4-5-6(2)7(8)9-3/h6H,4-5H2,1-3H3.
What are the key properties of methyl 2-methylpentanoate?
methyl 2-methylpentanoate has a molecular weight of 130.19 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylpentanoate is sourced from PubChem (CID 519890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).