About methyl 5-methylhexanoate
methyl 5-methylhexanoate (PubChem CID 519894) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is methyl 5-methylhexanoate.
Molecular Properties
| Compound Name | methyl 5-methylhexanoate |
| PubChem CID | 519894 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | methyl 5-methylhexanoate |
| SMILES | COC(=O)CCCC(C)C |
| InChI | InChI=1S/C8H16O2/c1-7(2)5-4-6-8(9)10-3/h7H,4-6H2,1-3H3 |
| InChIKey | VMHVFMBDCWCBHO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 5-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methylhexanoate?
The IUPAC name of methyl 5-methylhexanoate (CID 519894) is methyl 5-methylhexanoate.
What is the SMILES notation for methyl 5-methylhexanoate?
The canonical SMILES for methyl 5-methylhexanoate is COC(=O)CCCC(C)C.
What is the InChIKey of methyl 5-methylhexanoate?
The InChIKey is VMHVFMBDCWCBHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-7(2)5-4-6-8(9)10-3/h7H,4-6H2,1-3H3.
What are the key properties of methyl 5-methylhexanoate?
methyl 5-methylhexanoate has a molecular weight of 144.21 g/mol, XLogP of 1.99, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methylhexanoate is sourced from PubChem (CID 519894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).