About 1-isocyanoethylbenzene
1-isocyanoethylbenzene (PubChem CID 519905) has the molecular formula C9H9N
and a molecular weight of 131.18 g/mol. Its IUPAC name is 1-isocyanoethylbenzene.
Molecular Properties
| Compound Name | 1-isocyanoethylbenzene |
| PubChem CID | 519905 |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 1-isocyanoethylbenzene |
| SMILES | [C-]#[N+]C(C)c1ccccc1 |
| InChI | InChI=1S/C9H9N/c1-8(10-2)9-6-4-3-5-7-9/h3-8H,1H3 |
| InChIKey | KCCAPMXVCPVFEH-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanoethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanoethylbenzene?
The IUPAC name of 1-isocyanoethylbenzene (CID 519905) is 1-isocyanoethylbenzene.
What is the SMILES notation for 1-isocyanoethylbenzene?
The canonical SMILES for 1-isocyanoethylbenzene is [C-]#[N+]C(C)c1ccccc1.
What is the InChIKey of 1-isocyanoethylbenzene?
The InChIKey is KCCAPMXVCPVFEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N/c1-8(10-2)9-6-4-3-5-7-9/h3-8H,1H3.
What are the key properties of 1-isocyanoethylbenzene?
1-isocyanoethylbenzene has a molecular weight of 131.18 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanoethylbenzene is sourced from PubChem (CID 519905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).