C22H23ClFNO — CID 51992135
(2R)-N-[[2-[(2-chloro-6-fluorophenyl)methoxy]naphthalen-1-yl]methyl]butan-2-amine (PubChem CID 51992135) has the molecular formula C22H23ClFNO and a molecular weight of 371.88 g/mol. Its IUPAC name is (2R)-N-[[2-[(2-chloro-6-fluorophenyl)methoxy]naphthalen-1-yl]methyl]butan-2-amine.
| Compound Name | (2R)-N-[[2-[(2-chloro-6-fluorophenyl)methoxy]naphthalen-1-yl]methyl]butan-2-amine |
|---|---|
| PubChem CID | 51992135 |
| Molecular Formula | C22H23ClFNO |
| Molecular Weight | 371.88 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (2R)-N-[[2-[(2-chloro-6-fluorophenyl)methoxy]naphthalen-1-yl]methyl]butan-2-amine |
| SMILES | CC[C@@H](C)NCc1c(OCc2c(F)cccc2Cl)ccc2ccccc12 |
| InChI | InChI=1S/C22H23ClFNO/c1-3-15(2)25-13-18-17-8-5-4-7-16(17)11-12-22(18)26-14-19-20(23)9-6-10-21(19)24/h4-12,15,25H,3,13-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | UICXNUNTBQKZTQ-OAHLLOKOSA-N |
| XLogP | 6.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.88 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |