C23H25NO — CID 51993062
(1R)-N-[[3-[(3-methylphenyl)methoxy]phenyl]methyl]-1-phenylethanamine (PubChem CID 51993062) has the molecular formula C23H25NO and a molecular weight of 331.46 g/mol. Its IUPAC name is (1R)-N-[[3-[(3-methylphenyl)methoxy]phenyl]methyl]-1-phenylethanamine.
| Compound Name | (1R)-N-[[3-[(3-methylphenyl)methoxy]phenyl]methyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 51993062 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (1R)-N-[[3-[(3-methylphenyl)methoxy]phenyl]methyl]-1-phenylethanamine |
| SMILES | Cc1cccc(COc2cccc(CN[C@H](C)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C23H25NO/c1-18-8-6-10-21(14-18)17-25-23-13-7-9-20(15-23)16-24-19(2)22-11-4-3-5-12-22/h3-15,19,24H,16-17H2,1-2H3/t19-/m1/s1 |
| InChIKey | YSTVWTDBKGGESU-LJQANCHMSA-N |
| XLogP | 5.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |