About methyl 2-propylpentanoate
methyl 2-propylpentanoate (PubChem CID 519972) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is methyl 2-propylpentanoate.
Molecular Properties
| Compound Name | methyl 2-propylpentanoate |
| PubChem CID | 519972 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | methyl 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)OC |
| InChI | InChI=1S/C9H18O2/c1-4-6-8(7-5-2)9(10)11-3/h8H,4-7H2,1-3H3 |
| InChIKey | WPRYUWYMOZQHIY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 2-propylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-propylpentanoate?
The IUPAC name of methyl 2-propylpentanoate (CID 519972) is methyl 2-propylpentanoate.
What is the SMILES notation for methyl 2-propylpentanoate?
The canonical SMILES for methyl 2-propylpentanoate is CCCC(CCC)C(=O)OC.
What is the InChIKey of methyl 2-propylpentanoate?
The InChIKey is WPRYUWYMOZQHIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-4-6-8(7-5-2)9(10)11-3/h8H,4-7H2,1-3H3.
What are the key properties of methyl 2-propylpentanoate?
methyl 2-propylpentanoate has a molecular weight of 158.24 g/mol, XLogP of 2.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-propylpentanoate is sourced from PubChem (CID 519972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).