About N-(2,2-diethoxyethyl)aniline
N-(2,2-diethoxyethyl)aniline (PubChem CID 519978) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)aniline.
Molecular Properties
| Compound Name | N-(2,2-diethoxyethyl)aniline |
| PubChem CID | 519978 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-(2,2-diethoxyethyl)aniline |
| SMILES | CCOC(CNc1ccccc1)OCC |
| InChI | InChI=1S/C12H19NO2/c1-3-14-12(15-4-2)10-13-11-8-6-5-7-9-11/h5-9,12-13H,3-4,10H2,1-2H3 |
| InChIKey | DHGUGEBXVGPRRD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-diethoxyethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-diethoxyethyl)aniline?
The IUPAC name of N-(2,2-diethoxyethyl)aniline (CID 519978) is N-(2,2-diethoxyethyl)aniline.
What is the SMILES notation for N-(2,2-diethoxyethyl)aniline?
The canonical SMILES for N-(2,2-diethoxyethyl)aniline is CCOC(CNc1ccccc1)OCC.
What is the InChIKey of N-(2,2-diethoxyethyl)aniline?
The InChIKey is DHGUGEBXVGPRRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-3-14-12(15-4-2)10-13-11-8-6-5-7-9-11/h5-9,12-13H,3-4,10H2,1-2H3.
What are the key properties of N-(2,2-diethoxyethyl)aniline?
N-(2,2-diethoxyethyl)aniline has a molecular weight of 209.29 g/mol, XLogP of 2.50, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-diethoxyethyl)aniline is sourced from PubChem (CID 519978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).