C20H25ClN4O2 — CID 51999876
N-[2-(3-chlorophenyl)ethyl]-5-(cyclohexanecarbonylamino)-1-methylpyrazole-3-carboxamide (PubChem CID 51999876) has the molecular formula C20H25ClN4O2 and a molecular weight of 388.90 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-5-(cyclohexanecarbonylamino)-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-5-(cyclohexanecarbonylamino)-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 51999876 |
| Molecular Formula | C20H25ClN4O2 |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-5-(cyclohexanecarbonylamino)-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1nc(C(=O)NCCc2cccc(Cl)c2)cc1NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C20H25ClN4O2/c1-25-18(23-19(26)15-7-3-2-4-8-15)13-17(24-25)20(27)22-11-10-14-6-5-9-16(21)12-14/h5-6,9,12-13,15H,2-4,7-8,10-11H2,1H3,(H,22,27)(H,23,26) |
| InChIKey | GJOKIQNFMLNLKJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |