About 7-amino-3,4-dihydro-1H-quinolin-2-one
7-amino-3,4-dihydro-1H-quinolin-2-one (PubChem CID 5200242) has the molecular formula C9H10N2O
and a molecular weight of 162.19 g/mol. Its IUPAC name is 7-amino-3,4-dihydro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 7-amino-3,4-dihydro-1H-quinolin-2-one |
| PubChem CID | 5200242 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 7-amino-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Nc1ccc2c(c1)NC(=O)CC2 |
| InChI | InChI=1S/C9H10N2O/c10-7-3-1-6-2-4-9(12)11-8(6)5-7/h1,3,5H,2,4,10H2,(H,11,12) |
| InChIKey | KSQKSHQUEREEKM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-3,4-dihydro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-3,4-dihydro-1H-quinolin-2-one?
The IUPAC name of 7-amino-3,4-dihydro-1H-quinolin-2-one (CID 5200242) is 7-amino-3,4-dihydro-1H-quinolin-2-one.
What is the SMILES notation for 7-amino-3,4-dihydro-1H-quinolin-2-one?
The canonical SMILES for 7-amino-3,4-dihydro-1H-quinolin-2-one is Nc1ccc2c(c1)NC(=O)CC2.
What is the InChIKey of 7-amino-3,4-dihydro-1H-quinolin-2-one?
The InChIKey is KSQKSHQUEREEKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O/c10-7-3-1-6-2-4-9(12)11-8(6)5-7/h1,3,5H,2,4,10H2,(H,11,12).
What are the key properties of 7-amino-3,4-dihydro-1H-quinolin-2-one?
7-amino-3,4-dihydro-1H-quinolin-2-one has a molecular weight of 162.19 g/mol, XLogP of 1.15, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-3,4-dihydro-1H-quinolin-2-one is sourced from PubChem (CID 5200242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).