About 5-amino-2,4-dichlorobenzoic acid
5-amino-2,4-dichlorobenzoic acid (PubChem CID 5200245) has the molecular formula C7H5Cl2NO2
and a molecular weight of 206.03 g/mol. Its IUPAC name is 5-amino-2,4-dichlorobenzoic acid.
Molecular Properties
| Compound Name | 5-amino-2,4-dichlorobenzoic acid |
| PubChem CID | 5200245 |
| Molecular Formula | C7H5Cl2NO2 |
| Molecular Weight | 206.03 g/mol |
| Exact Mass | 204.97 |
| IUPAC Name | 5-amino-2,4-dichlorobenzoic acid |
| SMILES | Nc1cc(C(=O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C7H5Cl2NO2/c8-4-2-5(9)6(10)1-3(4)7(11)12/h1-2H,10H2,(H,11,12) |
| InChIKey | GWQAKTJQXQZZNO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.03 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2,4-dichlorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,4-dichlorobenzoic acid?
The IUPAC name of 5-amino-2,4-dichlorobenzoic acid (CID 5200245) is 5-amino-2,4-dichlorobenzoic acid.
What is the SMILES notation for 5-amino-2,4-dichlorobenzoic acid?
The canonical SMILES for 5-amino-2,4-dichlorobenzoic acid is Nc1cc(C(=O)O)c(Cl)cc1Cl.
What is the InChIKey of 5-amino-2,4-dichlorobenzoic acid?
The InChIKey is GWQAKTJQXQZZNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5Cl2NO2/c8-4-2-5(9)6(10)1-3(4)7(11)12/h1-2H,10H2,(H,11,12).
What are the key properties of 5-amino-2,4-dichlorobenzoic acid?
5-amino-2,4-dichlorobenzoic acid has a molecular weight of 206.03 g/mol, XLogP of 2.27, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,4-dichlorobenzoic acid is sourced from PubChem (CID 5200245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).