C7H8N2O — CID 5200288
2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one (PubChem CID 5200288) has the molecular formula C7H8N2O and a molecular weight of 136.15 g/mol. Its IUPAC name is 2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one.
| Compound Name | 2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one |
|---|---|
| PubChem CID | 5200288 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 2,5,6,7-tetrahydrocyclopenta[c]pyridazin-3-one |
| SMILES | O=c1cc2c(n[nH]1)CCC2 |
| InChI | InChI=1S/C7H8N2O/c10-7-4-5-2-1-3-6(5)8-9-7/h4H,1-3H2,(H,9,10) |
| InChIKey | HZLVYABRXDPPSA-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |