C14H5N5O — CID 5200326
2-oxospiro[1H-indole-3,3'-cyclopropane]-1',1',2',2'-tetracarbonitrile (PubChem CID 5200326) has the molecular formula C14H5N5O and a molecular weight of 259.23 g/mol. Its IUPAC name is 2-oxospiro[1H-indole-3,3'-cyclopropane]-1',1',2',2'-tetracarbonitrile.
| Compound Name | 2-oxospiro[1H-indole-3,3'-cyclopropane]-1',1',2',2'-tetracarbonitrile |
|---|---|
| PubChem CID | 5200326 |
| Molecular Formula | C14H5N5O |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-oxospiro[1H-indole-3,3'-cyclopropane]-1',1',2',2'-tetracarbonitrile |
| SMILES | N#CC1(C#N)C(C#N)(C#N)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C14H5N5O/c15-5-12(6-16)13(7-17,8-18)14(12)9-3-1-2-4-10(9)19-11(14)20/h1-4H,(H,19,20) |
| InChIKey | SMJKTPWKNZJCRJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|