C10H13NO — CID 5200345
8-methoxy-1,2,3,4-tetrahydroquinoline (PubChem CID 5200345) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 8-methoxy-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-methoxy-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 5200345 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 8-methoxy-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1cccc2c1NCCC2 |
| InChI | InChI=1S/C10H13NO/c1-12-9-6-2-4-8-5-3-7-11-10(8)9/h2,4,6,11H,3,5,7H2,1H3 |
| InChIKey | ZPRWUIXDTQZKJO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |