C11H14N4 — CID 5200441
1-(5-methyl-1-pyridin-2-ylpyrazol-4-yl)ethanamine (PubChem CID 5200441) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 1-(5-methyl-1-pyridin-2-ylpyrazol-4-yl)ethanamine.
| Compound Name | 1-(5-methyl-1-pyridin-2-ylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 5200441 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 1-(5-methyl-1-pyridin-2-ylpyrazol-4-yl)ethanamine |
| SMILES | Cc1c(C(C)N)cnn1-c1ccccn1 |
| InChI | InChI=1S/C11H14N4/c1-8(12)10-7-14-15(9(10)2)11-5-3-4-6-13-11/h3-8H,12H2,1-2H3 |
| InChIKey | OGRPHIGFGXFUOU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |