About butyl 4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate
butyl 4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate (PubChem CID 520053) has the molecular formula C11H18F3NO3S
and a molecular weight of 301.33 g/mol. Its IUPAC name is butyl 4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate.
Molecular Properties
| Compound Name | butyl 4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate |
| PubChem CID | 520053 |
| Molecular Formula | C11H18F3NO3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | butyl 4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate |
| SMILES | CCCCOC(=O)C(CCSC)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H18F3NO3S/c1-3-4-6-18-9(16)8(5-7-19-2)15-10(17)11(12,13)14/h8H,3-7H2,1-2H3,(H,15,17) |
| InChIKey | GMLYSZLQJGGOFS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate?
The IUPAC name of butyl 4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate (CID 520053) is butyl 4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate.
What is the SMILES notation for butyl 4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate?
The canonical SMILES for butyl 4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate is CCCCOC(=O)C(CCSC)NC(=O)C(F)(F)F.
What is the InChIKey of butyl 4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate?
The InChIKey is GMLYSZLQJGGOFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO3S/c1-3-4-6-18-9(16)8(5-7-19-2)15-10(17)11(12,13)14/h8H,3-7H2,1-2H3,(H,15,17).
What are the key properties of butyl 4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate?
butyl 4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate has a molecular weight of 301.33 g/mol, XLogP of 2.13, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 4-methylsulfanyl-2-[(2,2,2-trifluoroacetyl)amino]butanoate is sourced from PubChem (CID 520053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).