C9H8F4 — CID 5200972
3,3,4,4-tetrafluorotricyclo[4.2.1.02,5]non-7-ene (PubChem CID 5200972) has the molecular formula C9H8F4 and a molecular weight of 192.15 g/mol. Its IUPAC name is 3,3,4,4-tetrafluorotricyclo[4.2.1.02,5]non-7-ene.
| Compound Name | 3,3,4,4-tetrafluorotricyclo[4.2.1.02,5]non-7-ene |
|---|---|
| PubChem CID | 5200972 |
| Molecular Formula | C9H8F4 |
| Molecular Weight | 192.15 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 3,3,4,4-tetrafluorotricyclo[4.2.1.02,5]non-7-ene |
| SMILES | FC1(F)C2C3C=CC(C3)C2C1(F)F |
| InChI | InChI=1S/C9H8F4/c10-8(11)6-4-1-2-5(3-4)7(6)9(8,12)13/h1-2,4-7H,3H2 |
| InChIKey | RKBDIAMXCKXCEJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.15 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|