About 1,2-diphenylguanidine;hydrochloride
1,2-diphenylguanidine;hydrochloride (PubChem CID 520104) has the molecular formula C13H14ClN3
and a molecular weight of 247.73 g/mol. Its IUPAC name is 1,2-diphenylguanidine;hydrochloride.
Molecular Properties
| Compound Name | 1,2-diphenylguanidine;hydrochloride |
| PubChem CID | 520104 |
| Molecular Formula | C13H14ClN3 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 1,2-diphenylguanidine;hydrochloride |
| SMILES | Cl.N/C(=N\c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C13H13N3.ClH/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12;/h1-10H,(H3,14,15,16);1H |
| InChIKey | IEDHGYYAGIASNQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diphenylguanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diphenylguanidine;hydrochloride?
The IUPAC name of 1,2-diphenylguanidine;hydrochloride (CID 520104) is 1,2-diphenylguanidine;hydrochloride.
What is the SMILES notation for 1,2-diphenylguanidine;hydrochloride?
The canonical SMILES for 1,2-diphenylguanidine;hydrochloride is Cl.N/C(=N\c1ccccc1)Nc1ccccc1.
What is the InChIKey of 1,2-diphenylguanidine;hydrochloride?
The InChIKey is IEDHGYYAGIASNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3.ClH/c14-13(15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12;/h1-10H,(H3,14,15,16);1H.
What are the key properties of 1,2-diphenylguanidine;hydrochloride?
1,2-diphenylguanidine;hydrochloride has a molecular weight of 247.73 g/mol, XLogP of 3.17, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenylguanidine;hydrochloride is sourced from PubChem (CID 520104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).