C20H23ClN2O5S — CID 5201160
N-(4-chlorophenyl)-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carboxamide (PubChem CID 5201160) has the molecular formula C20H23ClN2O5S and a molecular weight of 438.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 5201160 |
| Molecular Formula | C20H23ClN2O5S |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | N-(4-chlorophenyl)-1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCCC(C(=O)Nc3ccc(Cl)cc3)C2)cc1OC |
| InChI | InChI=1S/C20H23ClN2O5S/c1-27-18-10-9-17(12-19(18)28-2)29(25,26)23-11-3-4-14(13-23)20(24)22-16-7-5-15(21)6-8-16/h5-10,12,14H,3-4,11,13H2,1-2H3,(H,22,24) |
| InChIKey | SSOPFDXORQTQIH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |