About 8-methoxychromen-2-one
8-methoxychromen-2-one (PubChem CID 520130) has the molecular formula C10H8O3
and a molecular weight of 176.17 g/mol. Its IUPAC name is 8-methoxychromen-2-one.
Molecular Properties
| Compound Name | 8-methoxychromen-2-one |
| PubChem CID | 520130 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 8-methoxychromen-2-one |
| SMILES | COc1cccc2ccc(=O)oc12 |
| InChI | InChI=1S/C10H8O3/c1-12-8-4-2-3-7-5-6-9(11)13-10(7)8/h2-6H,1H3 |
| InChIKey | ODRDTKMYQDXVGG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxychromen-2-one?
The IUPAC name of 8-methoxychromen-2-one (CID 520130) is 8-methoxychromen-2-one.
What is the SMILES notation for 8-methoxychromen-2-one?
The canonical SMILES for 8-methoxychromen-2-one is COc1cccc2ccc(=O)oc12.
What is the InChIKey of 8-methoxychromen-2-one?
The InChIKey is ODRDTKMYQDXVGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3/c1-12-8-4-2-3-7-5-6-9(11)13-10(7)8/h2-6H,1H3.
What are the key properties of 8-methoxychromen-2-one?
8-methoxychromen-2-one has a molecular weight of 176.17 g/mol, XLogP of 1.80, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxychromen-2-one is sourced from PubChem (CID 520130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).