C28H25BrN2O4S2 — CID 5201414
[4-[2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate (PubChem CID 5201414) has the molecular formula C28H25BrN2O4S2 and a molecular weight of 597.56 g/mol. Its IUPAC name is [4-[2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate.
| Compound Name | [4-[2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 5201414 |
| Molecular Formula | C28H25BrN2O4S2 |
| Molecular Weight | 597.56 g/mol |
| Exact Mass | 596.04 |
| IUPAC Name | [4-[2-(4-bromophenyl)sulfonylimino-3-cyclohexyl-1,3-thiazol-4-yl]phenyl] benzoate |
| SMILES | O=C(Oc1ccc(-c2csc(=NS(=O)(=O)c3ccc(Br)cc3)n2C2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H25BrN2O4S2/c29-22-13-17-25(18-14-22)37(33,34)30-28-31(23-9-5-2-6-10-23)26(19-36-28)20-11-15-24(16-12-20)35-27(32)21-7-3-1-4-8-21/h1,3-4,7-8,11-19,23H,2,5-6,9-10H2 |
| InChIKey | BYCSFQVHSKZQHC-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.56 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|