About cyclopropyl-(2,5-dichlorothiophen-3-yl)methanamine
cyclopropyl-(2,5-dichlorothiophen-3-yl)methanamine (PubChem CID 5201764) has the molecular formula C8H9Cl2NS
and a molecular weight of 222.14 g/mol. Its IUPAC name is cyclopropyl-(2,5-dichlorothiophen-3-yl)methanamine.
Molecular Properties
| Compound Name | cyclopropyl-(2,5-dichlorothiophen-3-yl)methanamine |
| PubChem CID | 5201764 |
| Molecular Formula | C8H9Cl2NS |
| Molecular Weight | 222.14 g/mol |
| Exact Mass | 220.98 |
| IUPAC Name | cyclopropyl-(2,5-dichlorothiophen-3-yl)methanamine |
| SMILES | NC(c1cc(Cl)sc1Cl)C1CC1 |
| InChI | InChI=1S/C8H9Cl2NS/c9-6-3-5(8(10)12-6)7(11)4-1-2-4/h3-4,7H,1-2,11H2 |
| InChIKey | IRTIACRJBOVLME-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.14 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropyl-(2,5-dichlorothiophen-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl-(2,5-dichlorothiophen-3-yl)methanamine?
The IUPAC name of cyclopropyl-(2,5-dichlorothiophen-3-yl)methanamine (CID 5201764) is cyclopropyl-(2,5-dichlorothiophen-3-yl)methanamine.
What is the SMILES notation for cyclopropyl-(2,5-dichlorothiophen-3-yl)methanamine?
The canonical SMILES for cyclopropyl-(2,5-dichlorothiophen-3-yl)methanamine is NC(c1cc(Cl)sc1Cl)C1CC1.
What is the InChIKey of cyclopropyl-(2,5-dichlorothiophen-3-yl)methanamine?
The InChIKey is IRTIACRJBOVLME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9Cl2NS/c9-6-3-5(8(10)12-6)7(11)4-1-2-4/h3-4,7H,1-2,11H2.
What are the key properties of cyclopropyl-(2,5-dichlorothiophen-3-yl)methanamine?
cyclopropyl-(2,5-dichlorothiophen-3-yl)methanamine has a molecular weight of 222.14 g/mol, XLogP of 3.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl-(2,5-dichlorothiophen-3-yl)methanamine is sourced from PubChem (CID 5201764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).