C21H16N2O3S2 — CID 5201796
3-(4-methoxyphenyl)-2-phenacylsulfanylthieno[3,2-d]pyrimidin-4-one (PubChem CID 5201796) has the molecular formula C21H16N2O3S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2-phenacylsulfanylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-(4-methoxyphenyl)-2-phenacylsulfanylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 5201796 |
| Molecular Formula | C21H16N2O3S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 3-(4-methoxyphenyl)-2-phenacylsulfanylthieno[3,2-d]pyrimidin-4-one |
| SMILES | COc1ccc(-n2c(SCC(=O)c3ccccc3)nc3ccsc3c2=O)cc1 |
| InChI | InChI=1S/C21H16N2O3S2/c1-26-16-9-7-15(8-10-16)23-20(25)19-17(11-12-27-19)22-21(23)28-13-18(24)14-5-3-2-4-6-14/h2-12H,13H2,1H3 |
| InChIKey | VPNDSPQWPMBZDL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |