About methyl 6-methylheptanoate
methyl 6-methylheptanoate (PubChem CID 520188) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is methyl 6-methylheptanoate.
Molecular Properties
| Compound Name | methyl 6-methylheptanoate |
| PubChem CID | 520188 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | methyl 6-methylheptanoate |
| SMILES | COC(=O)CCCCC(C)C |
| InChI | InChI=1S/C9H18O2/c1-8(2)6-4-5-7-9(10)11-3/h8H,4-7H2,1-3H3 |
| InChIKey | QIYDQYBDGDYJKD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-methylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-methylheptanoate?
The IUPAC name of methyl 6-methylheptanoate (CID 520188) is methyl 6-methylheptanoate.
What is the SMILES notation for methyl 6-methylheptanoate?
The canonical SMILES for methyl 6-methylheptanoate is COC(=O)CCCCC(C)C.
What is the InChIKey of methyl 6-methylheptanoate?
The InChIKey is QIYDQYBDGDYJKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-8(2)6-4-5-7-9(10)11-3/h8H,4-7H2,1-3H3.
What are the key properties of methyl 6-methylheptanoate?
methyl 6-methylheptanoate has a molecular weight of 158.24 g/mol, XLogP of 2.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methylheptanoate is sourced from PubChem (CID 520188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).