About 2-fluorobenzenethiol
2-fluorobenzenethiol (PubChem CID 520216) has the molecular formula C6H5FS
and a molecular weight of 128.17 g/mol. Its IUPAC name is 2-fluorobenzenethiol.
Molecular Properties
| Compound Name | 2-fluorobenzenethiol |
| PubChem CID | 520216 |
| Molecular Formula | C6H5FS |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.01 |
| IUPAC Name | 2-fluorobenzenethiol |
| SMILES | Fc1ccccc1S |
| InChI | InChI=1S/C6H5FS/c7-5-3-1-2-4-6(5)8/h1-4,8H |
| InChIKey | WJTZZPVVTSDNJJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-fluorobenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorobenzenethiol?
The IUPAC name of 2-fluorobenzenethiol (CID 520216) is 2-fluorobenzenethiol.
What is the SMILES notation for 2-fluorobenzenethiol?
The canonical SMILES for 2-fluorobenzenethiol is Fc1ccccc1S.
What is the InChIKey of 2-fluorobenzenethiol?
The InChIKey is WJTZZPVVTSDNJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FS/c7-5-3-1-2-4-6(5)8/h1-4,8H.
What are the key properties of 2-fluorobenzenethiol?
2-fluorobenzenethiol has a molecular weight of 128.17 g/mol, XLogP of 2.11, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorobenzenethiol is sourced from PubChem (CID 520216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).