C11H14N2O3S — CID 5202229
methyl 5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate (PubChem CID 5202229) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is methyl 5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate.
| Compound Name | methyl 5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate |
|---|---|
| PubChem CID | 5202229 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | methyl 5-(2-oxo-1,3-dihydrothieno[3,4-d]imidazol-4-yl)pentanoate |
| SMILES | COC(=O)CCCCc1scc2[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C11H14N2O3S/c1-16-9(14)5-3-2-4-8-10-7(6-17-8)12-11(15)13-10/h6H,2-5H2,1H3,(H2,12,13,15) |
| InChIKey | YISDUGVWGWVLRC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|