About 2-benzylpropane-1,3-diol
2-benzylpropane-1,3-diol (PubChem CID 520241) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 2-benzylpropane-1,3-diol.
Molecular Properties
| Compound Name | 2-benzylpropane-1,3-diol |
| PubChem CID | 520241 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2-benzylpropane-1,3-diol |
| SMILES | OCC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C10H14O2/c11-7-10(8-12)6-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2 |
| InChIKey | LODRGECCKZZTEQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzylpropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylpropane-1,3-diol?
The IUPAC name of 2-benzylpropane-1,3-diol (CID 520241) is 2-benzylpropane-1,3-diol.
What is the SMILES notation for 2-benzylpropane-1,3-diol?
The canonical SMILES for 2-benzylpropane-1,3-diol is OCC(CO)Cc1ccccc1.
What is the InChIKey of 2-benzylpropane-1,3-diol?
The InChIKey is LODRGECCKZZTEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c11-7-10(8-12)6-9-4-2-1-3-5-9/h1-5,10-12H,6-8H2.
What are the key properties of 2-benzylpropane-1,3-diol?
2-benzylpropane-1,3-diol has a molecular weight of 166.22 g/mol, XLogP of 0.83, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylpropane-1,3-diol is sourced from PubChem (CID 520241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).