C14H18F4 — CID 5202429
1,4-ditert-butyl-2,3,5,6-tetrafluorobenzene (PubChem CID 5202429) has the molecular formula C14H18F4 and a molecular weight of 262.29 g/mol. Its IUPAC name is 1,4-ditert-butyl-2,3,5,6-tetrafluorobenzene.
| Compound Name | 1,4-ditert-butyl-2,3,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 5202429 |
| Molecular Formula | C14H18F4 |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1,4-ditert-butyl-2,3,5,6-tetrafluorobenzene |
| SMILES | CC(C)(C)c1c(F)c(F)c(C(C)(C)C)c(F)c1F |
| InChI | InChI=1S/C14H18F4/c1-13(2,3)7-9(15)11(17)8(14(4,5)6)12(18)10(7)16/h1-6H3 |
| InChIKey | SOUQAPNRIRYTOB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|