About 1,1-diethylcyclopentane
1,1-diethylcyclopentane (PubChem CID 520297) has the molecular formula C9H18
and a molecular weight of 126.24 g/mol. Its IUPAC name is 1,1-diethylcyclopentane.
Molecular Properties
| Compound Name | 1,1-diethylcyclopentane |
| PubChem CID | 520297 |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.14 |
| IUPAC Name | 1,1-diethylcyclopentane |
| SMILES | CCC1(CC)CCCC1 |
| InChI | InChI=1S/C9H18/c1-3-9(4-2)7-5-6-8-9/h3-8H2,1-2H3 |
| InChIKey | DPGQSDLGKGLNHC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-diethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethylcyclopentane?
The IUPAC name of 1,1-diethylcyclopentane (CID 520297) is 1,1-diethylcyclopentane.
What is the SMILES notation for 1,1-diethylcyclopentane?
The canonical SMILES for 1,1-diethylcyclopentane is CCC1(CC)CCCC1.
What is the InChIKey of 1,1-diethylcyclopentane?
The InChIKey is DPGQSDLGKGLNHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18/c1-3-9(4-2)7-5-6-8-9/h3-8H2,1-2H3.
What are the key properties of 1,1-diethylcyclopentane?
1,1-diethylcyclopentane has a molecular weight of 126.24 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethylcyclopentane is sourced from PubChem (CID 520297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).