C19H16Cl2N2O3 — CID 5203144
4-(2,4-dichlorophenyl)-6-methoxy-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 5203144) has the molecular formula C19H16Cl2N2O3 and a molecular weight of 391.25 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-6-methoxy-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 4-(2,4-dichlorophenyl)-6-methoxy-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 5203144 |
| Molecular Formula | C19H16Cl2N2O3 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-6-methoxy-8-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | COc1cc([N+](=O)[O-])cc2c1NC(c1ccc(Cl)cc1Cl)C1CC=CC21 |
| InChI | InChI=1S/C19H16Cl2N2O3/c1-26-17-9-11(23(24)25)8-15-12-3-2-4-13(12)18(22-19(15)17)14-6-5-10(20)7-16(14)21/h2-3,5-9,12-13,18,22H,4H2,1H3 |
| InChIKey | JUZGYFWKGIPEEI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|