C18H15F3N4OS — CID 5203158
3-methyl-N-[[5-sulfanylidene-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 5203158) has the molecular formula C18H15F3N4OS and a molecular weight of 392.41 g/mol. Its IUPAC name is 3-methyl-N-[[5-sulfanylidene-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | 3-methyl-N-[[5-sulfanylidene-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 5203158 |
| Molecular Formula | C18H15F3N4OS |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 3-methyl-N-[[5-sulfanylidene-4-[3-(trifluoromethyl)phenyl]-1H-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | Cc1cccc(C(=O)NCc2n[nH]c(=S)n2-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H15F3N4OS/c1-11-4-2-5-12(8-11)16(26)22-10-15-23-24-17(27)25(15)14-7-3-6-13(9-14)18(19,20)21/h2-9H,10H2,1H3,(H,22,26)(H,24,27) |
| InChIKey | ZZOQKPYIIMPDBM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|