About [4-(furan-2-yl)-4,5-dihydro-1H-pyrazol-3-yl]-(4-methylphenyl)methanone
[4-(furan-2-yl)-4,5-dihydro-1H-pyrazol-3-yl]-(4-methylphenyl)methanone (PubChem CID 5203255) has the molecular formula C15H14N2O2
and a molecular weight of 254.29 g/mol. Its IUPAC name is [4-(furan-2-yl)-4,5-dihydro-1H-pyrazol-3-yl]-(4-methylphenyl)methanone.
Molecular Properties
| Compound Name | [4-(furan-2-yl)-4,5-dihydro-1H-pyrazol-3-yl]-(4-methylphenyl)methanone |
| PubChem CID | 5203255 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | [4-(furan-2-yl)-4,5-dihydro-1H-pyrazol-3-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)C2=NNCC2c2ccco2)cc1 |
| InChI | InChI=1S/C15H14N2O2/c1-10-4-6-11(7-5-10)15(18)14-12(9-16-17-14)13-3-2-8-19-13/h2-8,12,16H,9H2,1H3 |
| InChIKey | ITFSQNDCJDZYTA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(furan-2-yl)-4,5-dihydro-1H-pyrazol-3-yl]-(4-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(furan-2-yl)-4,5-dihydro-1H-pyrazol-3-yl]-(4-methylphenyl)methanone?
The IUPAC name of [4-(furan-2-yl)-4,5-dihydro-1H-pyrazol-3-yl]-(4-methylphenyl)methanone (CID 5203255) is [4-(furan-2-yl)-4,5-dihydro-1H-pyrazol-3-yl]-(4-methylphenyl)methanone.
What is the SMILES notation for [4-(furan-2-yl)-4,5-dihydro-1H-pyrazol-3-yl]-(4-methylphenyl)methanone?
The canonical SMILES for [4-(furan-2-yl)-4,5-dihydro-1H-pyrazol-3-yl]-(4-methylphenyl)methanone is Cc1ccc(C(=O)C2=NNCC2c2ccco2)cc1.
What is the InChIKey of [4-(furan-2-yl)-4,5-dihydro-1H-pyrazol-3-yl]-(4-methylphenyl)methanone?
The InChIKey is ITFSQNDCJDZYTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2/c1-10-4-6-11(7-5-10)15(18)14-12(9-16-17-14)13-3-2-8-19-13/h2-8,12,16H,9H2,1H3.
What are the key properties of [4-(furan-2-yl)-4,5-dihydro-1H-pyrazol-3-yl]-(4-methylphenyl)methanone?
[4-(furan-2-yl)-4,5-dihydro-1H-pyrazol-3-yl]-(4-methylphenyl)methanone has a molecular weight of 254.29 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(furan-2-yl)-4,5-dihydro-1H-pyrazol-3-yl]-(4-methylphenyl)methanone is sourced from PubChem (CID 5203255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).