C18H25FN2O3S — CID 5203427
cyclohexyl-[4-(2-fluoro-4-methylsulfonylphenyl)piperazin-1-yl]methanone (PubChem CID 5203427) has the molecular formula C18H25FN2O3S and a molecular weight of 368.47 g/mol. Its IUPAC name is cyclohexyl-[4-(2-fluoro-4-methylsulfonylphenyl)piperazin-1-yl]methanone.
| Compound Name | cyclohexyl-[4-(2-fluoro-4-methylsulfonylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 5203427 |
| Molecular Formula | C18H25FN2O3S |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | cyclohexyl-[4-(2-fluoro-4-methylsulfonylphenyl)piperazin-1-yl]methanone |
| SMILES | CS(=O)(=O)c1ccc(N2CCN(C(=O)C3CCCCC3)CC2)c(F)c1 |
| InChI | InChI=1S/C18H25FN2O3S/c1-25(23,24)15-7-8-17(16(19)13-15)20-9-11-21(12-10-20)18(22)14-5-3-2-4-6-14/h7-8,13-14H,2-6,9-12H2,1H3 |
| InChIKey | RRYVHLWPSHXJHB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |