C17H14N2S2 — CID 5203580
4-methyl-2,7-diphenyl-1lambda4,8-dithia-2,3-diazabicyclo[3.3.0]octa-1(5),3,6-triene (PubChem CID 5203580) has the molecular formula C17H14N2S2 and a molecular weight of 310.45 g/mol. Its IUPAC name is 4-methyl-2,7-diphenyl-1lambda4,8-dithia-2,3-diazabicyclo[3.3.0]octa-1(5),3,6-triene.
| Compound Name | 4-methyl-2,7-diphenyl-1lambda4,8-dithia-2,3-diazabicyclo[3.3.0]octa-1(5),3,6-triene |
|---|---|
| PubChem CID | 5203580 |
| Molecular Formula | C17H14N2S2 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 4-methyl-2,7-diphenyl-1lambda4,8-dithia-2,3-diazabicyclo[3.3.0]octa-1(5),3,6-triene |
| SMILES | CC1=NN(c2ccccc2)S2=C1C=C(c1ccccc1)S2 |
| InChI | InChI=1S/C17H14N2S2/c1-13-17-12-16(14-8-4-2-5-9-14)20-21(17)19(18-13)15-10-6-3-7-11-15/h2-12H,1H3 |
| InChIKey | YGUXUVUWLPDPDS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|