C14H7F11N2O3 — CID 5203706
1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-(2-methyl-4-nitrophenyl)cyclohexane-1-carboxamide (PubChem CID 5203706) has the molecular formula C14H7F11N2O3 and a molecular weight of 460.20 g/mol. Its IUPAC name is 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-(2-methyl-4-nitrophenyl)cyclohexane-1-carboxamide.
| Compound Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-(2-methyl-4-nitrophenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 5203706 |
| Molecular Formula | C14H7F11N2O3 |
| Molecular Weight | 460.20 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoro-N-(2-methyl-4-nitrophenyl)cyclohexane-1-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H7F11N2O3/c1-5-4-6(27(29)30)2-3-7(5)26-8(28)9(15)10(16,17)12(20,21)14(24,25)13(22,23)11(9,18)19/h2-4H,1H3,(H,26,28) |
| InChIKey | FXOWMYQHOKRSME-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.20 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|