C16H19N3O3S — CID 5204530
N-[(2-methyl-1,3-dioxoisoindol-5-yl)carbamothioyl]hexanamide (PubChem CID 5204530) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is N-[(2-methyl-1,3-dioxoisoindol-5-yl)carbamothioyl]hexanamide.
| Compound Name | N-[(2-methyl-1,3-dioxoisoindol-5-yl)carbamothioyl]hexanamide |
|---|---|
| PubChem CID | 5204530 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-[(2-methyl-1,3-dioxoisoindol-5-yl)carbamothioyl]hexanamide |
| SMILES | CCCCCC(=O)NC(=S)Nc1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C16H19N3O3S/c1-3-4-5-6-13(20)18-16(23)17-10-7-8-11-12(9-10)15(22)19(2)14(11)21/h7-9H,3-6H2,1-2H3,(H2,17,18,20,23) |
| InChIKey | IBUMARSMXLBUIO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|