C20H28O14 — CID 5204614
2,3,4,5,6,6-hexaacetyloxyhexyl acetate (PubChem CID 5204614) has the molecular formula C20H28O14 and a molecular weight of 492.43 g/mol. Its IUPAC name is 2,3,4,5,6,6-hexaacetyloxyhexyl acetate.
| Compound Name | 2,3,4,5,6,6-hexaacetyloxyhexyl acetate |
|---|---|
| PubChem CID | 5204614 |
| Molecular Formula | C20H28O14 |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 2,3,4,5,6,6-hexaacetyloxyhexyl acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C20H28O14/c1-9(21)28-8-16(29-10(2)22)17(30-11(3)23)18(31-12(4)24)19(32-13(5)25)20(33-14(6)26)34-15(7)27/h16-20H,8H2,1-7H3 |
| InChIKey | VDDHMTHDOZEEHK-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 184.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|