C6Cl5F9 — CID 520490
1,1,3,5,6-pentachloro-1,2,2,3,4,4,5,6,6-nonafluorohexane (PubChem CID 520490) has the molecular formula C6Cl5F9 and a molecular weight of 420.31 g/mol. Its IUPAC name is 1,1,3,5,6-pentachloro-1,2,2,3,4,4,5,6,6-nonafluorohexane.
| Compound Name | 1,1,3,5,6-pentachloro-1,2,2,3,4,4,5,6,6-nonafluorohexane |
|---|---|
| PubChem CID | 520490 |
| Molecular Formula | C6Cl5F9 |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 417.83 |
| IUPAC Name | 1,1,3,5,6-pentachloro-1,2,2,3,4,4,5,6,6-nonafluorohexane |
| SMILES | FC(F)(Cl)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)Cl |
| InChI | InChI=1S/C6Cl5F9/c7-1(12,4(16,17)5(9,10)18)3(14,15)2(8,13)6(11,19)20 |
| InChIKey | DVAVTWDOWVBESE-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|