C13H15I2NO3 — CID 5204986
2-(7,11-diiodo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl)ethyl nitrate (PubChem CID 5204986) has the molecular formula C13H15I2NO3 and a molecular weight of 487.08 g/mol. Its IUPAC name is 2-(7,11-diiodo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl)ethyl nitrate.
| Compound Name | 2-(7,11-diiodo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl)ethyl nitrate |
|---|---|
| PubChem CID | 5204986 |
| Molecular Formula | C13H15I2NO3 |
| Molecular Weight | 487.08 g/mol |
| Exact Mass | 486.91 |
| IUPAC Name | 2-(7,11-diiodo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl)ethyl nitrate |
| SMILES | O=[N+]([O-])OCCC12C(I)C3C4CC5C3C1C(I)C5C42 |
| InChI | InChI=1S/C13H15I2NO3/c14-11-8-4-3-5-7-6(4)10(11)13(9(5)8,12(7)15)1-2-19-16(17)18/h4-12H,1-3H2 |
| InChIKey | KTJQNBGHXAEKPY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.08 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|