About 1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-1-one
1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-1-one (PubChem CID 520506) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is 1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-1-one.
Molecular Properties
| Compound Name | 1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-1-one |
| PubChem CID | 520506 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-1-one |
| SMILES | C=CCC(=O)C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C13H20O/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5,8,12H,1,6-7,9H2,2-4H3 |
| InChIKey | GCGZDUFEEQNVPR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-1-one?
The IUPAC name of 1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-1-one (CID 520506) is 1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-1-one.
What is the SMILES notation for 1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-1-one?
The canonical SMILES for 1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-1-one is C=CCC(=O)C1C(C)=CCCC1(C)C.
What is the InChIKey of 1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-1-one?
The InChIKey is GCGZDUFEEQNVPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O/c1-5-7-11(14)12-10(2)8-6-9-13(12,3)4/h5,8,12H,1,6-7,9H2,2-4H3.
What are the key properties of 1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-1-one?
1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-1-one has a molecular weight of 192.30 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6,6-trimethylcyclohex-2-en-1-yl)but-3-en-1-one is sourced from PubChem (CID 520506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).