About (3-chlorophenyl) diethyl phosphate
(3-chlorophenyl) diethyl phosphate (PubChem CID 520553) has the molecular formula C10H14ClO4P
and a molecular weight of 264.64 g/mol. Its IUPAC name is (3-chlorophenyl) diethyl phosphate.
Molecular Properties
| Compound Name | (3-chlorophenyl) diethyl phosphate |
| PubChem CID | 520553 |
| Molecular Formula | C10H14ClO4P |
| Molecular Weight | 264.64 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | (3-chlorophenyl) diethyl phosphate |
| SMILES | CCOP(=O)(OCC)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C10H14ClO4P/c1-3-13-16(12,14-4-2)15-10-7-5-6-9(11)8-10/h5-8H,3-4H2,1-2H3 |
| InChIKey | OXUXCXDESUJMFE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.64 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-chlorophenyl) diethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl) diethyl phosphate?
The IUPAC name of (3-chlorophenyl) diethyl phosphate (CID 520553) is (3-chlorophenyl) diethyl phosphate.
What is the SMILES notation for (3-chlorophenyl) diethyl phosphate?
The canonical SMILES for (3-chlorophenyl) diethyl phosphate is CCOP(=O)(OCC)Oc1cccc(Cl)c1.
What is the InChIKey of (3-chlorophenyl) diethyl phosphate?
The InChIKey is OXUXCXDESUJMFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClO4P/c1-3-13-16(12,14-4-2)15-10-7-5-6-9(11)8-10/h5-8H,3-4H2,1-2H3.
What are the key properties of (3-chlorophenyl) diethyl phosphate?
(3-chlorophenyl) diethyl phosphate has a molecular weight of 264.64 g/mol, XLogP of 3.90, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl) diethyl phosphate is sourced from PubChem (CID 520553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).