C12H14N2OS — CID 5205722
6-methoxy-2-pyrrolidin-1-yl-1,3-benzothiazole (PubChem CID 5205722) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 6-methoxy-2-pyrrolidin-1-yl-1,3-benzothiazole.
| Compound Name | 6-methoxy-2-pyrrolidin-1-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 5205722 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 6-methoxy-2-pyrrolidin-1-yl-1,3-benzothiazole |
| SMILES | COc1ccc2nc(N3CCCC3)sc2c1 |
| InChI | InChI=1S/C12H14N2OS/c1-15-9-4-5-10-11(8-9)16-12(13-10)14-6-2-3-7-14/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | KYRDMSGXPQAQMM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |