About hexa-3,5-dien-2-ol
hexa-3,5-dien-2-ol (PubChem CID 520595) has the molecular formula C6H10O
and a molecular weight of 98.14 g/mol. Its IUPAC name is hexa-3,5-dien-2-ol.
Molecular Properties
| Compound Name | hexa-3,5-dien-2-ol |
| PubChem CID | 520595 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.14 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | hexa-3,5-dien-2-ol |
| SMILES | C=CC=CC(C)O |
| InChI | InChI=1S/C6H10O/c1-3-4-5-6(2)7/h3-7H,1H2,2H3 |
| InChIKey | VAOJQRMYAXTUQI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.14 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze hexa-3,5-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexa-3,5-dien-2-ol?
The IUPAC name of hexa-3,5-dien-2-ol (CID 520595) is hexa-3,5-dien-2-ol.
What is the SMILES notation for hexa-3,5-dien-2-ol?
The canonical SMILES for hexa-3,5-dien-2-ol is C=CC=CC(C)O.
What is the InChIKey of hexa-3,5-dien-2-ol?
The InChIKey is VAOJQRMYAXTUQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O/c1-3-4-5-6(2)7/h3-7H,1H2,2H3.
What are the key properties of hexa-3,5-dien-2-ol?
hexa-3,5-dien-2-ol has a molecular weight of 98.14 g/mol, XLogP of 1.11, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexa-3,5-dien-2-ol is sourced from PubChem (CID 520595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).