C26H22N2O4S — CID 5206400
ethyl 2-[2-(4-benzoylbenzoyl)imino-6-methyl-1,3-benzothiazol-3-yl]acetate (PubChem CID 5206400) has the molecular formula C26H22N2O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is ethyl 2-[2-(4-benzoylbenzoyl)imino-6-methyl-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[2-(4-benzoylbenzoyl)imino-6-methyl-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 5206400 |
| Molecular Formula | C26H22N2O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | ethyl 2-[2-(4-benzoylbenzoyl)imino-6-methyl-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2ccc(C(=O)c3ccccc3)cc2)sc2cc(C)ccc21 |
| InChI | InChI=1S/C26H22N2O4S/c1-3-32-23(29)16-28-21-14-9-17(2)15-22(21)33-26(28)27-25(31)20-12-10-19(11-13-20)24(30)18-7-5-4-6-8-18/h4-15H,3,16H2,1-2H3/b27-26- |
| InChIKey | RVOUJBQGAABOHE-RQZHXJHFSA-N |
| XLogP | 4.55 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |