C16H28N2O2 — CID 5206430
1,4-bis(azepan-1-yl)butane-1,4-dione (PubChem CID 5206430) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 1,4-bis(azepan-1-yl)butane-1,4-dione.
| Compound Name | 1,4-bis(azepan-1-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 5206430 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1,4-bis(azepan-1-yl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CCCCCC1)N1CCCCCC1 |
| InChI | InChI=1S/C16H28N2O2/c19-15(17-11-5-1-2-6-12-17)9-10-16(20)18-13-7-3-4-8-14-18/h1-14H2 |
| InChIKey | BBMCLZUXIOMELQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |