About 4-chloro-N-[2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)cyclohexyl]benzenesulfonamide
4-chloro-N-[2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)cyclohexyl]benzenesulfonamide (PubChem CID 5206584) has the molecular formula C15H19ClN2O2S3
and a molecular weight of 390.98 g/mol. Its IUPAC name is 4-chloro-N-[2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)cyclohexyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-chloro-N-[2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)cyclohexyl]benzenesulfonamide |
| PubChem CID | 5206584 |
| Molecular Formula | C15H19ClN2O2S3 |
| Molecular Weight | 390.98 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 4-chloro-N-[2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)cyclohexyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1SC1=NCCS1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H19ClN2O2S3/c16-11-5-7-12(8-6-11)23(19,20)18-13-3-1-2-4-14(13)22-15-17-9-10-21-15/h5-8,13-14,18H,1-4,9-10H2 |
| InChIKey | YZRNHAQRJVDEAQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.98 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-N-[2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)cyclohexyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)cyclohexyl]benzenesulfonamide?
The IUPAC name of 4-chloro-N-[2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)cyclohexyl]benzenesulfonamide (CID 5206584) is 4-chloro-N-[2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)cyclohexyl]benzenesulfonamide.
What is the SMILES notation for 4-chloro-N-[2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)cyclohexyl]benzenesulfonamide?
The canonical SMILES for 4-chloro-N-[2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)cyclohexyl]benzenesulfonamide is O=S(=O)(NC1CCCCC1SC1=NCCS1)c1ccc(Cl)cc1.
What is the InChIKey of 4-chloro-N-[2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)cyclohexyl]benzenesulfonamide?
The InChIKey is YZRNHAQRJVDEAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClN2O2S3/c16-11-5-7-12(8-6-11)23(19,20)18-13-3-1-2-4-14(13)22-15-17-9-10-21-15/h5-8,13-14,18H,1-4,9-10H2.
What are the key properties of 4-chloro-N-[2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)cyclohexyl]benzenesulfonamide?
4-chloro-N-[2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)cyclohexyl]benzenesulfonamide has a molecular weight of 390.98 g/mol, XLogP of 3.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[2-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)cyclohexyl]benzenesulfonamide is sourced from PubChem (CID 5206584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).